Examlex
Provide the proper IUPAC name for CH3CHOHCH2COCH2C(CH3)2CH2CH3.
Hypnotist
A person skilled in hypnosis, the practice of inducing a trance-like state to increase the subject's suggestibility.
Automatically
Occurring or operating in a way that is independent of conscious control or decision.
Temporarily Deaf
A temporary loss of hearing, which can be caused by various factors such as exposure to loud noise, infections, or blockages.
Hypnotized
A state of highly focused attention or concentration, often associated with relaxation and heightened suggestibility.
Q1: Show the hydrogen bonding which occurs when
Q2: Provide the structure of isotactic polystyrene.
Q18: Circle and name the aromatic heterocycles in
Q25: How does vulcanization of rubber alter its
Q31: Which sequence ranks the following carbonyl compounds
Q35: Provide the structure of the major organic
Q42: The CCN bond angle in acrylonitrile (CH<sub>2</sub>=CHCN)
Q44: Provide the structures of the monomers from
Q66: At low temperatures, long-chain polymers are usually
Q129: Provide the structure of the major organic