Examlex
Provide the proper IUPAC name for CH3CHOHCH2COCH2C(CH3)2CH2CH3.
Negative Reinforcement
A behavioural strategy that involves the removal of an unpleasant stimulus to increase the likelihood of a desired response.
Contingent
Dependent on or conditioned by something else; occurring or existing only if certain circumstances are the case.
Unpleasant Event
An incident or occurrence that causes discomfort, distress, or dissatisfaction.
Pleasant Event
An occurrence or experience that brings joy, satisfaction, or happiness to those involved.
Q11: What is the major product of the
Q18: Give one reason why <sup>13</sup>C NMR is
Q29: Which of the following is highest in
Q46: Which enantiomer is formed from attack of
Q79: What materials are needed to prepare the
Q91: Which molecule below has two significant bands
Q98: Provide the reagents necessary for carrying out
Q102: What is the name of the following
Q116: Which of the following esters undergoes hydrolysis
Q127: When cyclopentanol is treated with chromic acid,